C20H34O3 — CID 101320285
(1S,2R,4aS,4bR,7R,8aR,10aR)-7-ethenyl-1-(hydroxymethyl)-1,4b,7-trimethyl-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,10a-diol (PubChem CID 101320285) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1S,2R,4aS,4bR,7R,8aR,10aR)-7-ethenyl-1-(hydroxymethyl)-1,4b,7-trimethyl-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,10a-diol.
| Compound Name | (1S,2R,4aS,4bR,7R,8aR,10aR)-7-ethenyl-1-(hydroxymethyl)-1,4b,7-trimethyl-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,10a-diol |
|---|---|
| PubChem CID | 101320285 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1S,2R,4aS,4bR,7R,8aR,10aR)-7-ethenyl-1-(hydroxymethyl)-1,4b,7-trimethyl-2,3,4,4a,5,6,8,8a,9,10-decahydrophenanthrene-2,10a-diol |
| SMILES | C=C[C@]1(C)CC[C@]2(C)[C@H](CC[C@@]3(O)[C@H]2CC[C@@H](O)[C@]3(C)CO)C1 |
| InChI | InChI=1S/C20H34O3/c1-5-17(2)10-11-18(3)14(12-17)8-9-20(23)15(18)6-7-16(22)19(20,4)13-21/h5,14-16,21-23H,1,6-13H2,2-4H3/t14-,15+,16-,17-,18-,19+,20-/m1/s1 |
| InChIKey | ZARKXXVUJFPNPY-RCGQGYBOSA-N |
| XLogP | 3.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|