C21H32O3 — CID 166634974
(1R,4S,6S,9S,10R,12S,15S)-6-ethenyl-15-methoxy-6,9-dimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadec-13-en-12-ol (PubChem CID 166634974) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1R,4S,6S,9S,10R,12S,15S)-6-ethenyl-15-methoxy-6,9-dimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadec-13-en-12-ol.
| Compound Name | (1R,4S,6S,9S,10R,12S,15S)-6-ethenyl-15-methoxy-6,9-dimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadec-13-en-12-ol |
|---|---|
| PubChem CID | 166634974 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1R,4S,6S,9S,10R,12S,15S)-6-ethenyl-15-methoxy-6,9-dimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadec-13-en-12-ol |
| SMILES | C=C[C@@]1(C)CC[C@@]2(C)[C@@H](CC[C@]34CO[C@H](OC)C3=C[C@@H](O)C[C@@H]42)C1 |
| InChI | InChI=1S/C21H32O3/c1-5-19(2)8-9-20(3)14(12-19)6-7-21-13-24-18(23-4)16(21)10-15(22)11-17(20)21/h5,10,14-15,17-18,22H,1,6-9,11-13H2,2-4H3/t14-,15+,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | VMTSJVFJNZNDCO-ZICUHAMLSA-N |
| XLogP | 4.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|