C20H32O2 — CID 101020019
(1R,4R,6R,9S,10S)-6-ethenyl-6,14,14-trimethyl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadecan-16-ol (PubChem CID 101020019) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,4R,6R,9S,10S)-6-ethenyl-6,14,14-trimethyl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadecan-16-ol.
| Compound Name | (1R,4R,6R,9S,10S)-6-ethenyl-6,14,14-trimethyl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadecan-16-ol |
|---|---|
| PubChem CID | 101020019 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,4R,6R,9S,10S)-6-ethenyl-6,14,14-trimethyl-15-oxatetracyclo[7.5.2.01,10.04,9]hexadecan-16-ol |
| SMILES | C=C[C@]1(C)CC[C@]23C(O)O[C@]4(CC[C@@H]2C1)[C@H]3CCCC4(C)C |
| InChI | InChI=1S/C20H32O2/c1-5-18(4)11-12-19-14(13-18)8-10-20(22-16(19)21)15(19)7-6-9-17(20,2)3/h5,14-16,21H,1,6-13H2,2-4H3/t14-,15+,16?,18-,19+,20-/m1/s1 |
| InChIKey | KMMOJMQDSAPQSS-RQNPOXFISA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|