C20H32O2 — CID 162979123
(1R,2R,5R,7S,10R,11S)-5-ethenyl-2,5,11-trimethyl-13,14-dioxatetracyclo[9.3.3.01,10.02,7]heptadecane (PubChem CID 162979123) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,2R,5R,7S,10R,11S)-5-ethenyl-2,5,11-trimethyl-13,14-dioxatetracyclo[9.3.3.01,10.02,7]heptadecane.
| Compound Name | (1R,2R,5R,7S,10R,11S)-5-ethenyl-2,5,11-trimethyl-13,14-dioxatetracyclo[9.3.3.01,10.02,7]heptadecane |
|---|---|
| PubChem CID | 162979123 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,2R,5R,7S,10R,11S)-5-ethenyl-2,5,11-trimethyl-13,14-dioxatetracyclo[9.3.3.01,10.02,7]heptadecane |
| SMILES | C=C[C@]1(C)CC[C@]2(C)[C@@H](CC[C@@H]3[C@]4(C)CCC[C@@]32OOC4)C1 |
| InChI | InChI=1S/C20H32O2/c1-5-17(2)11-12-19(4)15(13-17)7-8-16-18(3)9-6-10-20(16,19)22-21-14-18/h5,15-16H,1,6-14H2,2-4H3/t15-,16+,17+,18+,19+,20+/m0/s1 |
| InChIKey | QUHWZVUCAYSQGE-RFVXBFLTSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|