C20H32O3 — CID 5318505
(6S)-2-ethenyl-6,8a-dihydroxy-2,4a,8,8-tetramethyl-4,4b,5,6,7,9,10,10a-octahydro-1H-phenanthren-3-one (PubChem CID 5318505) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (6S)-2-ethenyl-6,8a-dihydroxy-2,4a,8,8-tetramethyl-4,4b,5,6,7,9,10,10a-octahydro-1H-phenanthren-3-one.
| Compound Name | (6S)-2-ethenyl-6,8a-dihydroxy-2,4a,8,8-tetramethyl-4,4b,5,6,7,9,10,10a-octahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 5318505 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (6S)-2-ethenyl-6,8a-dihydroxy-2,4a,8,8-tetramethyl-4,4b,5,6,7,9,10,10a-octahydro-1H-phenanthren-3-one |
| SMILES | C=CC1(C)CC2CCC3(O)C(C[C@H](O)CC3(C)C)C2(C)CC1=O |
| InChI | InChI=1S/C20H32O3/c1-6-18(4)10-13-7-8-20(23)15(19(13,5)12-16(18)22)9-14(21)11-17(20,2)3/h6,13-15,21,23H,1,7-12H2,2-5H3/t13?,14-,15?,18?,19?,20?/m0/s1 |
| InChIKey | PMJUFRYZMSQUQD-SHLGWOPSSA-N |
| XLogP | 3.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|