C14H18O5 — CID 163055230
(1S,4S,7R,8S,11R,12R,13S)-13-ethenyl-1,7-dihydroxy-12-methyl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridecan-9-one (PubChem CID 163055230) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1S,4S,7R,8S,11R,12R,13S)-13-ethenyl-1,7-dihydroxy-12-methyl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridecan-9-one.
| Compound Name | (1S,4S,7R,8S,11R,12R,13S)-13-ethenyl-1,7-dihydroxy-12-methyl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridecan-9-one |
|---|---|
| PubChem CID | 163055230 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,4S,7R,8S,11R,12R,13S)-13-ethenyl-1,7-dihydroxy-12-methyl-2,10-dioxatetracyclo[5.4.1.18,11.04,12]tridecan-9-one |
| SMILES | C=C[C@@H]1[C@H]2OC(=O)[C@@H]1[C@]1(O)CC[C@@H]3CO[C@@]2(O)[C@]31C |
| InChI | InChI=1S/C14H18O5/c1-3-8-9-11(15)19-10(8)14(17)12(2)7(6-18-14)4-5-13(9,12)16/h3,7-10,16-17H,1,4-6H2,2H3/t7-,8+,9-,10-,12-,13-,14-/m1/s1 |
| InChIKey | OZRZMHKATMSFPV-NLTGAPFQSA-N |
| XLogP | 0.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|