C15H20O3 — CID 177426839
(1S,2R,6S,8S,11R)-2-hydroxy-6-methyl-5-methylidene-11-prop-1-en-2-yl-9-oxatricyclo[6.2.1.02,6]undecan-10-one (PubChem CID 177426839) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,2R,6S,8S,11R)-2-hydroxy-6-methyl-5-methylidene-11-prop-1-en-2-yl-9-oxatricyclo[6.2.1.02,6]undecan-10-one.
| Compound Name | (1S,2R,6S,8S,11R)-2-hydroxy-6-methyl-5-methylidene-11-prop-1-en-2-yl-9-oxatricyclo[6.2.1.02,6]undecan-10-one |
|---|---|
| PubChem CID | 177426839 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,2R,6S,8S,11R)-2-hydroxy-6-methyl-5-methylidene-11-prop-1-en-2-yl-9-oxatricyclo[6.2.1.02,6]undecan-10-one |
| SMILES | C=C(C)[C@@H]1[C@@H]2C[C@@]3(C)C(=C)CC[C@@]3(O)[C@H]1C(=O)O2 |
| InChI | InChI=1S/C15H20O3/c1-8(2)11-10-7-14(4)9(3)5-6-15(14,17)12(11)13(16)18-10/h10-12,17H,1,3,5-7H2,2,4H3/t10-,11+,12+,14-,15+/m0/s1 |
| InChIKey | XSFUUQYSLHHUJM-SIJPQNPESA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|