C11H18O3 — CID 122390419
(3aR,5R,7S,7aS)-3-hydroxy-3a,5,7-trimethyl-3,4,5,6,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 122390419) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3aR,5R,7S,7aS)-3-hydroxy-3a,5,7-trimethyl-3,4,5,6,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aR,5R,7S,7aS)-3-hydroxy-3a,5,7-trimethyl-3,4,5,6,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 122390419 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3aR,5R,7S,7aS)-3-hydroxy-3a,5,7-trimethyl-3,4,5,6,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]2C(=O)OC(O)[C@]2(C)C1 |
| InChI | InChI=1S/C11H18O3/c1-6-4-7(2)8-9(12)14-10(13)11(8,3)5-6/h6-8,10,13H,4-5H2,1-3H3/t6-,7+,8-,10?,11-/m1/s1 |
| InChIKey | QHWNPXCDHAOQKC-KCQCMJENSA-N |
| XLogP | 1.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |