C22H34O3 — CID 101439360
methyl (1S,2R,4aR,4bR,6S,8R,8aS,9S,9aR)-2-ethenyl-9-hydroxy-2,4,4b,6,8-pentamethyl-4a,5,6,7,8,8a,9,9a-octahydro-1H-fluorene-1-carboxylate (PubChem CID 101439360) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is methyl (1S,2R,4aR,4bR,6S,8R,8aS,9S,9aR)-2-ethenyl-9-hydroxy-2,4,4b,6,8-pentamethyl-4a,5,6,7,8,8a,9,9a-octahydro-1H-fluorene-1-carboxylate.
| Compound Name | methyl (1S,2R,4aR,4bR,6S,8R,8aS,9S,9aR)-2-ethenyl-9-hydroxy-2,4,4b,6,8-pentamethyl-4a,5,6,7,8,8a,9,9a-octahydro-1H-fluorene-1-carboxylate |
|---|---|
| PubChem CID | 101439360 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | methyl (1S,2R,4aR,4bR,6S,8R,8aS,9S,9aR)-2-ethenyl-9-hydroxy-2,4,4b,6,8-pentamethyl-4a,5,6,7,8,8a,9,9a-octahydro-1H-fluorene-1-carboxylate |
| SMILES | C=C[C@]1(C)C=C(C)[C@H]2[C@@H]([C@H](O)[C@H]3[C@H](C)C[C@H](C)C[C@@]32C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C22H34O3/c1-8-21(5)11-14(4)16-15(18(21)20(24)25-7)19(23)17-13(3)9-12(2)10-22(16,17)6/h8,11-13,15-19,23H,1,9-10H2,2-7H3/t12-,13+,15+,16-,17+,18+,19-,21+,22+/m0/s1 |
| InChIKey | WHHSNGVQZPGPSF-JWPDSAMDSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|