C17H26O3 — CID 177412138
ethyl (4aR,6S,8R,8aR)-3,4a,6,8-tetramethyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 177412138) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl (4aR,6S,8R,8aR)-3,4a,6,8-tetramethyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (4aR,6S,8R,8aR)-3,4a,6,8-tetramethyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 177412138 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl (4aR,6S,8R,8aR)-3,4a,6,8-tetramethyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C)=C[C@]2(C)C[C@@H](C)C[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C17H26O3/c1-6-20-16(19)13-14-11(3)7-10(2)8-17(14,5)9-12(4)15(13)18/h9-11,13-14H,6-8H2,1-5H3/t10-,11+,13?,14+,17-/m0/s1 |
| InChIKey | PTTMEJMYVOKBHY-WJGPMDSESA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|