C20H26O6 — CID 162859728
5-ethenyl-2,8,9-trihydroxy-5,11-dimethyl-3-oxotetracyclo[8.5.0.01,14.02,7]pentadec-6-ene-11-carboxylic acid (PubChem CID 162859728) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is 5-ethenyl-2,8,9-trihydroxy-5,11-dimethyl-3-oxotetracyclo[8.5.0.01,14.02,7]pentadec-6-ene-11-carboxylic acid.
| Compound Name | 5-ethenyl-2,8,9-trihydroxy-5,11-dimethyl-3-oxotetracyclo[8.5.0.01,14.02,7]pentadec-6-ene-11-carboxylic acid |
|---|---|
| PubChem CID | 162859728 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 5-ethenyl-2,8,9-trihydroxy-5,11-dimethyl-3-oxotetracyclo[8.5.0.01,14.02,7]pentadec-6-ene-11-carboxylic acid |
| SMILES | C=CC1(C)C=C2C(O)C(O)C3C(C)(C(=O)O)CCC4CC43C2(O)C(=O)C1 |
| InChI | InChI=1S/C20H26O6/c1-4-17(2)8-11-13(22)14(23)15-18(3,16(24)25)6-5-10-7-19(10,15)20(11,26)12(21)9-17/h4,8,10,13-15,22-23,26H,1,5-7,9H2,2-3H3,(H,24,25) |
| InChIKey | VMXWBYJIKIBRRH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|