C15H23NO — CID 10988169
4-[(1R,3R,6S)-1,6-dimethyl-2-methylidene-3-(2-oxoethyl)cyclohexyl]butanenitrile (PubChem CID 10988169) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-[(1R,3R,6S)-1,6-dimethyl-2-methylidene-3-(2-oxoethyl)cyclohexyl]butanenitrile.
| Compound Name | 4-[(1R,3R,6S)-1,6-dimethyl-2-methylidene-3-(2-oxoethyl)cyclohexyl]butanenitrile |
|---|---|
| PubChem CID | 10988169 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-[(1R,3R,6S)-1,6-dimethyl-2-methylidene-3-(2-oxoethyl)cyclohexyl]butanenitrile |
| SMILES | C=C1[C@@H](CC=O)CC[C@H](C)[C@@]1(C)CCCC#N |
| InChI | InChI=1S/C15H23NO/c1-12-6-7-14(8-11-17)13(2)15(12,3)9-4-5-10-16/h11-12,14H,2,4-9H2,1,3H3/t12-,14+,15+/m0/s1 |
| InChIKey | NYAYRZMOLYUECC-NWANDNLSSA-N |
| XLogP | 3.88 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|