C13H19NO — CID 24977198
1-ethyl-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexane-1-carbonitrile (PubChem CID 24977198) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-ethyl-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexane-1-carbonitrile.
| Compound Name | 1-ethyl-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 24977198 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-ethyl-2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexane-1-carbonitrile |
| SMILES | C=C(C)C1CC(=O)C(C)C(C#N)(CC)C1 |
| InChI | InChI=1S/C13H19NO/c1-5-13(8-14)7-11(9(2)3)6-12(15)10(13)4/h10-11H,2,5-7H2,1,3-4H3 |
| InChIKey | QRYYJDKBYFIQEX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|