C7H17N3O4S — CID 10988364
2-[[(2S)-2,5-diaminopentanoyl]amino]ethanesulfonic acid (PubChem CID 10988364) has the molecular formula C7H17N3O4S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[[(2S)-2,5-diaminopentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(2S)-2,5-diaminopentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 10988364 |
| Molecular Formula | C7H17N3O4S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 2-[[(2S)-2,5-diaminopentanoyl]amino]ethanesulfonic acid |
| SMILES | NCCC[C@H](N)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C7H17N3O4S/c8-3-1-2-6(9)7(11)10-4-5-15(12,13)14/h6H,1-5,8-9H2,(H,10,11)(H,12,13,14)/t6-/m0/s1 |
| InChIKey | JALOHEZOHSEEMS-LURJTMIESA-N |
| XLogP | -1.94 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|