C12H19NO4 — CID 10988424
methyl (6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10988424) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl (6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl (6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10988424 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl (6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1CCC=C[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H19NO4/c1-12(2)16-8-10(17-12)9-6-4-5-7-13(9)11(14)15-3/h4,6,9-10H,5,7-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | APEVUOPDKOYXMV-VHSXEESVSA-N |
| XLogP | 1.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|