C14H23NO4 — CID 11448587
methyl N-but-3-enyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]carbamate (PubChem CID 11448587) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl N-but-3-enyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]carbamate.
| Compound Name | methyl N-but-3-enyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 11448587 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | methyl N-but-3-enyl-N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]carbamate |
| SMILES | C=CCCN(C(=O)OC)[C@@H](C=C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H23NO4/c1-6-8-9-15(13(16)17-5)11(7-2)12-10-18-14(3,4)19-12/h6-7,11-12H,1-2,8-10H2,3-5H3/t11-,12+/m0/s1 |
| InChIKey | CBWWKSSFUVILIY-NWDGAFQWSA-N |
| XLogP | 2.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|