C12H16N2Se — CID 10989227
N,N,4-trimethyl-2-phenyl-5H-1,3-selenazol-4-amine (PubChem CID 10989227) has the molecular formula C12H16N2Se and a molecular weight of 267.23 g/mol. Its IUPAC name is N,N,4-trimethyl-2-phenyl-5H-1,3-selenazol-4-amine.
| Compound Name | N,N,4-trimethyl-2-phenyl-5H-1,3-selenazol-4-amine |
|---|---|
| PubChem CID | 10989227 |
| Molecular Formula | C12H16N2Se |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N,N,4-trimethyl-2-phenyl-5H-1,3-selenazol-4-amine |
| SMILES | CN(C)C1(C)C[Se]C(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H16N2Se/c1-12(14(2)3)9-15-11(13-12)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | MLCWKZKCJCVCES-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|