C17H22O4 — CID 10989911
4-[(1R,4S)-2-bicyclo[2.2.1]hepta-2,5-dienyl]-4-hydroxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one (PubChem CID 10989911) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-[(1R,4S)-2-bicyclo[2.2.1]hepta-2,5-dienyl]-4-hydroxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one.
| Compound Name | 4-[(1R,4S)-2-bicyclo[2.2.1]hepta-2,5-dienyl]-4-hydroxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10989911 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-[(1R,4S)-2-bicyclo[2.2.1]hepta-2,5-dienyl]-4-hydroxy-2,3-di(propan-2-yloxy)cyclobut-2-en-1-one |
| SMILES | CC(C)OC1=C(OC(C)C)C(O)(C2=C[C@@H]3C=C[C@H]2C3)C1=O |
| InChI | InChI=1S/C17H22O4/c1-9(2)20-14-15(18)17(19,16(14)21-10(3)4)13-8-11-5-6-12(13)7-11/h5-6,8-12,19H,7H2,1-4H3/t11-,12+,17?/m1/s1 |
| InChIKey | ABGGNWWTRANEPY-XGDHHHFCSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|