C18H32OSi — CID 10989996
[(3R,3aS,3bR,6aR,7aS)-6-methylidene-1,2,3,3a,3b,4,5,6a,7,7a-decahydrocyclopenta[a]pentalen-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10989996) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(3R,3aS,3bR,6aR,7aS)-6-methylidene-1,2,3,3a,3b,4,5,6a,7,7a-decahydrocyclopenta[a]pentalen-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,3aS,3bR,6aR,7aS)-6-methylidene-1,2,3,3a,3b,4,5,6a,7,7a-decahydrocyclopenta[a]pentalen-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10989996 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(3R,3aS,3bR,6aR,7aS)-6-methylidene-1,2,3,3a,3b,4,5,6a,7,7a-decahydrocyclopenta[a]pentalen-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CC[C@H]2[C@@H]3[C@@H](CC[C@H]3O[Si](C)(C)C(C)(C)C)C[C@@H]12 |
| InChI | InChI=1S/C18H32OSi/c1-12-7-9-14-15(12)11-13-8-10-16(17(13)14)19-20(5,6)18(2,3)4/h13-17H,1,7-11H2,2-6H3/t13-,14+,15-,16+,17-/m0/s1 |
| InChIKey | MVODYIRSHJPAMT-NNXHMXCWSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|