C23H42OSi — CID 10338712
tert-butyl-[[(1R,5R,6S,8R,9R)-5,8-dimethyl-4-methylidene-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undecanyl]oxy]-dimethylsilane (PubChem CID 10338712) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is tert-butyl-[[(1R,5R,6S,8R,9R)-5,8-dimethyl-4-methylidene-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undecanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,5R,6S,8R,9R)-5,8-dimethyl-4-methylidene-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undecanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10338712 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | tert-butyl-[[(1R,5R,6S,8R,9R)-5,8-dimethyl-4-methylidene-9-propan-2-yl-6-tricyclo[6.3.0.01,5]undecanyl]oxy]-dimethylsilane |
| SMILES | C=C1CC[C@]23CC[C@H](C(C)C)[C@@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]13C |
| InChI | InChI=1S/C23H42OSi/c1-16(2)18-12-14-23-13-11-17(3)22(23,8)19(15-21(18,23)7)24-25(9,10)20(4,5)6/h16,18-19H,3,11-15H2,1-2,4-10H3/t18-,19+,21-,22+,23+/m1/s1 |
| InChIKey | ABLGLNFUHTUWQC-FUOIXIIKSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|