C17H32OSi — CID 15519993
[(3aR,9aR)-2,2-dimethyl-5-methylidene-3,3a,4,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-9-yl]oxy-trimethylsilane (PubChem CID 15519993) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is [(3aR,9aR)-2,2-dimethyl-5-methylidene-3,3a,4,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-9-yl]oxy-trimethylsilane.
| Compound Name | [(3aR,9aR)-2,2-dimethyl-5-methylidene-3,3a,4,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-9-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15519993 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [(3aR,9aR)-2,2-dimethyl-5-methylidene-3,3a,4,6,7,8,9,9a-octahydro-1H-cyclopenta[8]annulen-9-yl]oxy-trimethylsilane |
| SMILES | C=C1CCCC(O[Si](C)(C)C)[C@@H]2CC(C)(C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H32OSi/c1-13-8-7-9-16(18-19(4,5)6)15-12-17(2,3)11-14(15)10-13/h14-16H,1,7-12H2,2-6H3/t14-,15+,16?/m0/s1 |
| InChIKey | JDXQXJFFUUOFBF-QMRHZFGWSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|