C16H32OSi — CID 54360617
tert-butyl-dimethyl-[[(1R)-1,2,3-trimethyl-4-methylidenecyclopentyl]methoxy]silane (PubChem CID 54360617) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R)-1,2,3-trimethyl-4-methylidenecyclopentyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R)-1,2,3-trimethyl-4-methylidenecyclopentyl]methoxy]silane |
|---|---|
| PubChem CID | 54360617 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R)-1,2,3-trimethyl-4-methylidenecyclopentyl]methoxy]silane |
| SMILES | C=C1C[C@@](C)(CO[Si](C)(C)C(C)(C)C)C(C)C1C |
| InChI | InChI=1S/C16H32OSi/c1-12-10-16(7,14(3)13(12)2)11-17-18(8,9)15(4,5)6/h13-14H,1,10-11H2,2-9H3/t13?,14?,16-/m0/s1 |
| InChIKey | UMFLFFIJAGYHFH-XUJLQICISA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|