C20H38OSi — CID 162786793
tert-butyl-dimethyl-[[(1S,5R,6R)-2,2,6-trimethyl-3-tricyclo[3.3.3.01,5]undecanyl]oxy]silane (PubChem CID 162786793) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,5R,6R)-2,2,6-trimethyl-3-tricyclo[3.3.3.01,5]undecanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,5R,6R)-2,2,6-trimethyl-3-tricyclo[3.3.3.01,5]undecanyl]oxy]silane |
|---|---|
| PubChem CID | 162786793 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,5R,6R)-2,2,6-trimethyl-3-tricyclo[3.3.3.01,5]undecanyl]oxy]silane |
| SMILES | C[C@@H]1CC[C@@]23CCC[C@@]12CC(O[Si](C)(C)C(C)(C)C)C3(C)C |
| InChI | InChI=1S/C20H38OSi/c1-15-10-13-20-12-9-11-19(15,20)14-16(18(20,5)6)21-22(7,8)17(2,3)4/h15-16H,9-14H2,1-8H3/t15-,16?,19-,20-/m1/s1 |
| InChIKey | XEIJBUCOJUHDPV-FBXFACIRSA-N |
| XLogP | 6.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|