C21H40OSi — CID 135015487
tert-butyl-dimethyl-[[(1R,2R,5S)-2,10,10-trimethyl-6-tricyclo[6.3.0.01,5]undecanyl]methoxy]silane (PubChem CID 135015487) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,5S)-2,10,10-trimethyl-6-tricyclo[6.3.0.01,5]undecanyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,5S)-2,10,10-trimethyl-6-tricyclo[6.3.0.01,5]undecanyl]methoxy]silane |
|---|---|
| PubChem CID | 135015487 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,5S)-2,10,10-trimethyl-6-tricyclo[6.3.0.01,5]undecanyl]methoxy]silane |
| SMILES | C[C@@H]1CC[C@H]2C(CO[Si](C)(C)C(C)(C)C)CC3CC(C)(C)C[C@]312 |
| InChI | InChI=1S/C21H40OSi/c1-15-9-10-18-16(13-22-23(7,8)19(2,3)4)11-17-12-20(5,6)14-21(15,17)18/h15-18H,9-14H2,1-8H3/t15-,16?,17?,18+,21-/m1/s1 |
| InChIKey | QRZUMAVIDUQAAI-NZFYCRKHSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|