C21H40O2Si — CID 134889098
(1S,3aS,3bS,4R,6aS,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalen-4-ol (PubChem CID 134889098) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (1S,3aS,3bS,4R,6aS,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalen-4-ol.
| Compound Name | (1S,3aS,3bS,4R,6aS,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalen-4-ol |
|---|---|
| PubChem CID | 134889098 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (1S,3aS,3bS,4R,6aS,7aR)-1-[tert-butyl(dimethyl)silyl]oxy-3a,5,5,7a-tetramethyl-1,2,3,3b,4,6,6a,7-octahydrocyclopenta[a]pentalen-4-ol |
| SMILES | CC1(C)C[C@H]2C[C@@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]3(C)[C@H]2[C@H]1O |
| InChI | InChI=1S/C21H40O2Si/c1-18(2,3)24(8,9)23-15-10-11-20(6)16-14(13-21(15,20)7)12-19(4,5)17(16)22/h14-17,22H,10-13H2,1-9H3/t14-,15-,16+,17+,20-,21-/m0/s1 |
| InChIKey | VPMUKNIIMMIINA-XSUYJZTMSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|