C20H36O2Si — CID 139115209
(1S,2S,3S,6R,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-ol (PubChem CID 139115209) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is (1S,2S,3S,6R,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-ol.
| Compound Name | (1S,2S,3S,6R,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-ol |
|---|---|
| PubChem CID | 139115209 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (1S,2S,3S,6R,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-ol |
| SMILES | CC1(C)C[C@H]2C[C@@]23[C@@H]1[C@H]1[C@H](CC[C@H]1O[Si](C)(C)C(C)(C)C)[C@@H]3O |
| InChI | InChI=1S/C20H36O2Si/c1-18(2,3)23(6,7)22-14-9-8-13-15(14)16-19(4,5)10-12-11-20(12,16)17(13)21/h12-17,21H,8-11H2,1-7H3/t12-,13-,14+,15-,16+,17-,20-/m0/s1 |
| InChIKey | AACSTLHQFNJYHK-ONXWYGRMSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|