C26H48O5Si — CID 11102723
(1R,2S,3R,5S,7R,9S,10S,12R,13R,16R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6,12-tetramethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,9,10,12-tetrol (PubChem CID 11102723) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is (1R,2S,3R,5S,7R,9S,10S,12R,13R,16R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6,12-tetramethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,9,10,12-tetrol.
| Compound Name | (1R,2S,3R,5S,7R,9S,10S,12R,13R,16R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6,12-tetramethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,9,10,12-tetrol |
|---|---|
| PubChem CID | 11102723 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | (1R,2S,3R,5S,7R,9S,10S,12R,13R,16R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6,12-tetramethyltetracyclo[8.5.1.03,7.013,16]hexadecane-2,9,10,12-tetrol |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2[C@H]1C[C@H](O)[C@]1(O)C[C@@](C)(O)[C@@H]3CC[C@H]([C@@H]31)[C@@]2(C)O |
| InChI | InChI=1S/C26H48O5Si/c1-22(2,3)32(8,9)31-20-13-18-17(23(20,4)5)12-19(27)26(30)14-24(6,28)15-10-11-16(21(15)26)25(18,7)29/h15-21,27-30H,10-14H2,1-9H3/t15-,16-,17-,18-,19+,20+,21-,24-,25-,26-/m1/s1 |
| InChIKey | IYMPKNKDAVUKEM-LDGUIOIZSA-N |
| XLogP | 4.08 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|