C16H34O3Si — CID 11012111
2-[(1R,2R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3,3-dimethylcyclopentyl]ethanol (PubChem CID 11012111) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3,3-dimethylcyclopentyl]ethanol.
| Compound Name | 2-[(1R,2R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3,3-dimethylcyclopentyl]ethanol |
|---|---|
| PubChem CID | 11012111 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 2-[(1R,2R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3,3-dimethylcyclopentyl]ethanol |
| SMILES | CC1(C)C[C@@H](CO)[C@@H](CCO)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3Si/c1-15(2,3)20(6,7)19-14-13(8-9-17)12(11-18)10-16(14,4)5/h12-14,17-18H,8-11H2,1-7H3/t12-,13+,14+/m0/s1 |
| InChIKey | VNLLGJKJAJAAAX-BFHYXJOUSA-N |
| XLogP | 3.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|