C15H25NO6 — CID 10990687
4-O-tert-butyl 2-O,2-O'-diethyl pyrrolidine-2,2,4-tricarboxylate (PubChem CID 10990687) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O,2-O'-diethyl pyrrolidine-2,2,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 2-O,2-O'-diethyl pyrrolidine-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 10990687 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-O-tert-butyl 2-O,2-O'-diethyl pyrrolidine-2,2,4-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C(=O)OC(C)(C)C)CN1 |
| InChI | InChI=1S/C15H25NO6/c1-6-20-12(18)15(13(19)21-7-2)8-10(9-16-15)11(17)22-14(3,4)5/h10,16H,6-9H2,1-5H3 |
| InChIKey | VPXRZAUFOMJYDI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|