C14H25NO5S — CID 10990793
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(3-hydroxypropylsulfanyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 10990793) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(3-hydroxypropylsulfanyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(3-hydroxypropylsulfanyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10990793 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(3-hydroxypropylsulfanyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](SCCCO)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO5S/c1-14(2,3)20-13(18)15-9-10(21-7-5-6-16)8-11(15)12(17)19-4/h10-11,16H,5-9H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | OEIKRHUVRIQQIX-MNOVXSKESA-N |
| XLogP | 1.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|