C12H23NO3S — CID 102561828
methyl (4R)-4-hydroxy-1-[2-(2-methylpropylsulfanyl)ethyl]pyrrolidine-2-carboxylate (PubChem CID 102561828) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is methyl (4R)-4-hydroxy-1-[2-(2-methylpropylsulfanyl)ethyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (4R)-4-hydroxy-1-[2-(2-methylpropylsulfanyl)ethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102561828 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl (4R)-4-hydroxy-1-[2-(2-methylpropylsulfanyl)ethyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1C[C@@H](O)CN1CCSCC(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-9(2)8-17-5-4-13-7-10(14)6-11(13)12(15)16-3/h9-11,14H,4-8H2,1-3H3/t10-,11?/m1/s1 |
| InChIKey | WURILYRJAJDHDS-NFJWQWPMSA-N |
| XLogP | 0.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|