C12H23NO5 — CID 112632787
methyl 1-(2,2-diethoxyethyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 112632787) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 1-(2,2-diethoxyethyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2,2-diethoxyethyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632787 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | methyl 1-(2,2-diethoxyethyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCOC(CN1CC(O)CC1C(=O)OC)OCC |
| InChI | InChI=1S/C12H23NO5/c1-4-17-11(18-5-2)8-13-7-9(14)6-10(13)12(15)16-3/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | WIJVDHVEMQPSSV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|