C10H17NO5 — CID 112632826
methyl 4-hydroxy-1-(3-methoxy-3-oxopropyl)pyrrolidine-2-carboxylate (PubChem CID 112632826) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(3-methoxy-3-oxopropyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(3-methoxy-3-oxopropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632826 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | methyl 4-hydroxy-1-(3-methoxy-3-oxopropyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)CCN1CC(O)CC1C(=O)OC |
| InChI | InChI=1S/C10H17NO5/c1-15-9(13)3-4-11-6-7(12)5-8(11)10(14)16-2/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | PYZKUZCWFBCLJJ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |