C9H17NO4 — CID 112632729
methyl 4-hydroxy-1-(2-hydroxypropyl)pyrrolidine-2-carboxylate (PubChem CID 112632729) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(2-hydroxypropyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(2-hydroxypropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632729 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | methyl 4-hydroxy-1-(2-hydroxypropyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1CC(C)O |
| InChI | InChI=1S/C9H17NO4/c1-6(11)4-10-5-7(12)3-8(10)9(13)14-2/h6-8,11-12H,3-5H2,1-2H3 |
| InChIKey | IGPBMUVTYISDPJ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |