C11H19NO3 — CID 112632988
methyl 1-(2-cyclopropylethyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 112632988) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 1-(2-cyclopropylethyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2-cyclopropylethyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632988 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 1-(2-cyclopropylethyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1CCC1CC1 |
| InChI | InChI=1S/C11H19NO3/c1-15-11(14)10-6-9(13)7-12(10)5-4-8-2-3-8/h8-10,13H,2-7H2,1H3 |
| InChIKey | PDXIDBMRZPTBLM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |