C20H21FN4O2 — CID 1099108
2-N,4-N-bis(4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 1099108) has the molecular formula C20H21FN4O2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-N,4-N-bis(4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 1099108 |
| Molecular Formula | C20H21FN4O2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-N,4-N-bis(4-ethoxyphenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2ncc(F)c(Nc3ccc(OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C20H21FN4O2/c1-3-26-16-9-5-14(6-10-16)23-19-18(21)13-22-20(25-19)24-15-7-11-17(12-8-15)27-4-2/h5-13H,3-4H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | CAIIUUQRGUIPCF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |