C18H27N3O3 — CID 10991226
(2S)-2-[[(1R,2S,3S)-2-[2-(hydroxyamino)-2-oxoethyl]-3-propan-2-ylcyclopropyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 10991226) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S,3S)-2-[2-(hydroxyamino)-2-oxoethyl]-3-propan-2-ylcyclopropyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(1R,2S,3S)-2-[2-(hydroxyamino)-2-oxoethyl]-3-propan-2-ylcyclopropyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 10991226 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (2S)-2-[[(1R,2S,3S)-2-[2-(hydroxyamino)-2-oxoethyl]-3-propan-2-ylcyclopropyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)N[C@@H]1[C@@H](CC(=O)NO)[C@@H]1C(C)C |
| InChI | InChI=1S/C18H27N3O3/c1-11(2)16-13(10-15(22)21-24)17(16)20-14(18(23)19-3)9-12-7-5-4-6-8-12/h4-8,11,13-14,16-17,20,24H,9-10H2,1-3H3,(H,19,23)(H,21,22)/t13-,14-,16-,17+/m0/s1 |
| InChIKey | CNYDCBMMDLPFBA-NXNVCVFFSA-N |
| XLogP | 1.10 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|