C20H30N2O3 — CID 162063953
(2S)-2-benzyl-3-[(1R,2R)-3-[2-(hydroxyamino)-2-oxoethyl]-2-methyl-2-propan-2-ylcyclopropyl]-N-methylpropanamide (PubChem CID 162063953) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2S)-2-benzyl-3-[(1R,2R)-3-[2-(hydroxyamino)-2-oxoethyl]-2-methyl-2-propan-2-ylcyclopropyl]-N-methylpropanamide.
| Compound Name | (2S)-2-benzyl-3-[(1R,2R)-3-[2-(hydroxyamino)-2-oxoethyl]-2-methyl-2-propan-2-ylcyclopropyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 162063953 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (2S)-2-benzyl-3-[(1R,2R)-3-[2-(hydroxyamino)-2-oxoethyl]-2-methyl-2-propan-2-ylcyclopropyl]-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)C[C@@H]1C(CC(=O)NO)[C@]1(C)C(C)C |
| InChI | InChI=1S/C20H30N2O3/c1-13(2)20(3)16(17(20)12-18(23)22-25)11-15(19(24)21-4)10-14-8-6-5-7-9-14/h5-9,13,15-17,25H,10-12H2,1-4H3,(H,21,24)(H,22,23)/t15-,16-,17?,20-/m1/s1 |
| InChIKey | ZAFAHYJMXLOADH-NQSCIKMSSA-N |
| XLogP | 2.79 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|