C16H18O8 — CID 10991358
(4S,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone (PubChem CID 10991358) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is (4S,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone.
| Compound Name | (4S,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone |
|---|---|
| PubChem CID | 10991358 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (4S,7E,10S,13E,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,9,12,15-pentone |
| SMILES | C[C@@H]1OC(=O)/C=C/C(=O)[C@H](C)OC(=O)C[C@H](C)OC(=O)/C=C/C1=O |
| InChI | InChI=1S/C16H18O8/c1-9-8-16(21)24-11(3)13(18)5-7-15(20)23-10(2)12(17)4-6-14(19)22-9/h4-7,9-11H,8H2,1-3H3/b6-4+,7-5+/t9-,10-,11-/m0/s1 |
| InChIKey | SAVLSAHCZGGEGF-UERLMFEASA-N |
| XLogP | 0.44 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|