C16H22O6 — CID 90924685
(4S,10S,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione (PubChem CID 90924685) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (4S,10S,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione.
| Compound Name | (4S,10S,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
|---|---|
| PubChem CID | 90924685 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (4S,10S,16S)-4,10,16-trimethyl-1,5,11-trioxacyclohexadeca-7,13-diene-2,6,12-trione |
| SMILES | C[C@H]1CC=CC(=O)O[C@@H](C)CC(=O)O[C@@H](C)CC=CC(=O)O1 |
| InChI | InChI=1S/C16H22O6/c1-11-6-4-9-15(18)22-13(3)10-16(19)21-12(2)7-5-8-14(17)20-11/h4-5,8-9,11-13H,6-7,10H2,1-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | DDFFUOPVHNPKKO-AVGNSLFASA-N |
| XLogP | 2.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|