C21H24O3Si — CID 10991789
(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2H-furan-5-one (PubChem CID 10991789) has the molecular formula C21H24O3Si and a molecular weight of 352.51 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2H-furan-5-one.
| Compound Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10991789 |
| Molecular Formula | C21H24O3Si |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2H-furan-5-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C=CC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O3Si/c1-21(2,3)25(18-10-6-4-7-11-18,19-12-8-5-9-13-19)23-16-17-14-15-20(22)24-17/h4-15,17H,16H2,1-3H3/t17-/m1/s1 |
| InChIKey | VXTQWNKHHWYJRP-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|