C17H20O7S — CID 10992229
[(Z)-4-[(2R)-4-(benzenesulfonyl)-5-oxooxolan-2-yl]but-2-enyl] ethyl carbonate (PubChem CID 10992229) has the molecular formula C17H20O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is [(Z)-4-[(2R)-4-(benzenesulfonyl)-5-oxooxolan-2-yl]but-2-enyl] ethyl carbonate.
| Compound Name | [(Z)-4-[(2R)-4-(benzenesulfonyl)-5-oxooxolan-2-yl]but-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 10992229 |
| Molecular Formula | C17H20O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(Z)-4-[(2R)-4-(benzenesulfonyl)-5-oxooxolan-2-yl]but-2-enyl] ethyl carbonate |
| SMILES | CCOC(=O)OC/C=C\C[C@@H]1CC(S(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C17H20O7S/c1-2-22-17(19)23-11-7-6-8-13-12-15(16(18)24-13)25(20,21)14-9-4-3-5-10-14/h3-7,9-10,13,15H,2,8,11-12H2,1H3/b7-6-/t13-,15?/m1/s1 |
| InChIKey | AQNZBVLKWSUGEU-ZDTQEZSFSA-N |
| XLogP | 2.26 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|