C18H24FNO4S — CID 10992236
methyl (2R)-2-[[4-(6-(18F)fluorohex-1-ynyl)phenyl]sulfonylamino]-3-methylbutanoate (PubChem CID 10992236) has the molecular formula C18H24FNO4S and a molecular weight of 368.46 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(6-(18F)fluorohex-1-ynyl)phenyl]sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl (2R)-2-[[4-(6-(18F)fluorohex-1-ynyl)phenyl]sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10992236 |
| Molecular Formula | C18H24FNO4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | methyl (2R)-2-[[4-(6-(18F)fluorohex-1-ynyl)phenyl]sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NS(=O)(=O)c1ccc(C#CCCCC[18F])cc1)C(C)C |
| InChI | InChI=1S/C18H24FNO4S/c1-14(2)17(18(21)24-3)20-25(22,23)16-11-9-15(10-12-16)8-6-4-5-7-13-19/h9-12,14,17,20H,4-5,7,13H2,1-3H3/t17-/m1/s1/i19-1 |
| InChIKey | VWCRGZBMQTWGOQ-WHBREPHUSA-N |
| XLogP | 2.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|