C16H21NO4S — CID 67588453
(2S)-2-[(4-hept-1-ynylphenyl)sulfonylamino]propanoic acid (PubChem CID 67588453) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (2S)-2-[(4-hept-1-ynylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[(4-hept-1-ynylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 67588453 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2S)-2-[(4-hept-1-ynylphenyl)sulfonylamino]propanoic acid |
| SMILES | CCCCCC#Cc1ccc(S(=O)(=O)N[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-3-4-5-6-7-8-14-9-11-15(12-10-14)22(20,21)17-13(2)16(18)19/h9-13,17H,3-6H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | HDXSHODZOYQXKJ-ZDUSSCGKSA-N |
| XLogP | 2.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|