C20H21NO4S — CID 10992326
(6S,7R,7aS)-6-(benzenesulfonyl)-3,3-dimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 10992326) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is (6S,7R,7aS)-6-(benzenesulfonyl)-3,3-dimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6S,7R,7aS)-6-(benzenesulfonyl)-3,3-dimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10992326 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (6S,7R,7aS)-6-(benzenesulfonyl)-3,3-dimethyl-7-phenyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)OC[C@@H]2[C@@H](c3ccccc3)[C@H](S(=O)(=O)c3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C20H21NO4S/c1-20(2)21-16(13-25-20)17(14-9-5-3-6-10-14)18(19(21)22)26(23,24)15-11-7-4-8-12-15/h3-12,16-18H,13H2,1-2H3/t16-,17-,18+/m1/s1 |
| InChIKey | PKGHZAPGKACDTE-KURKYZTESA-N |
| XLogP | 2.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |