C16H21NO4S — CID 11782277
(7aS)-6-(benzenesulfonyl)-3,3,7,7-tetramethyl-6,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 11782277) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (7aS)-6-(benzenesulfonyl)-3,3,7,7-tetramethyl-6,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7aS)-6-(benzenesulfonyl)-3,3,7,7-tetramethyl-6,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 11782277 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (7aS)-6-(benzenesulfonyl)-3,3,7,7-tetramethyl-6,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CC1(C)C(S(=O)(=O)c2ccccc2)C(=O)N2[C@@H]1COC2(C)C |
| InChI | InChI=1S/C16H21NO4S/c1-15(2)12-10-21-16(3,4)17(12)14(18)13(15)22(19,20)11-8-6-5-7-9-11/h5-9,12-13H,10H2,1-4H3/t12-,13?/m1/s1 |
| InChIKey | NGUXZAKLLMWKRJ-PZORYLMUSA-N |
| XLogP | 1.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |