C20H20N6O3S — CID 10993571
2-[2-[(E)-(4-methoxyphenyl)methylidenecarbamothioyl]hydrazinyl]-N-(2-methyl-4-oxoquinazolin-3-yl)acetamide (PubChem CID 10993571) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 2-[2-[(E)-(4-methoxyphenyl)methylidenecarbamothioyl]hydrazinyl]-N-(2-methyl-4-oxoquinazolin-3-yl)acetamide.
| Compound Name | 2-[2-[(E)-(4-methoxyphenyl)methylidenecarbamothioyl]hydrazinyl]-N-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 10993571 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[2-[(E)-(4-methoxyphenyl)methylidenecarbamothioyl]hydrazinyl]-N-(2-methyl-4-oxoquinazolin-3-yl)acetamide |
| SMILES | COc1ccc(/C=N/C(=S)NNCC(=O)Nn2c(C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C20H20N6O3S/c1-13-23-17-6-4-3-5-16(17)19(28)26(13)25-18(27)12-22-24-20(30)21-11-14-7-9-15(29-2)10-8-14/h3-11,22H,12H2,1-2H3,(H,24,30)(H,25,27)/b21-11+ |
| InChIKey | LYNCLXNPAJNVTD-SRZZPIQSSA-N |
| XLogP | 1.28 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|