C17H14N6O3S — CID 15697007
1-(2-methyl-4-oxoquinazolin-3-yl)-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea (PubChem CID 15697007) has the molecular formula C17H14N6O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-(2-methyl-4-oxoquinazolin-3-yl)-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-(2-methyl-4-oxoquinazolin-3-yl)-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 15697007 |
| Molecular Formula | C17H14N6O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-(2-methyl-4-oxoquinazolin-3-yl)-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea |
| SMILES | Cc1nc2ccccc2c(=O)n1NC(=S)N/N=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14N6O3S/c1-11-19-15-8-3-2-7-14(15)16(24)22(11)21-17(27)20-18-10-12-5-4-6-13(9-12)23(25)26/h2-10H,1H3,(H2,20,21,27)/b18-10+ |
| InChIKey | RGNBTHKCFIHYAP-VCHYOVAHSA-N |
| XLogP | 2.07 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|