C24H21NO5S — CID 10993798
[(1S,2R)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] 2-oxo-2-phenylacetate (PubChem CID 10993798) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is [(1S,2R)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] 2-oxo-2-phenylacetate.
| Compound Name | [(1S,2R)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 10993798 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [(1S,2R)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] 2-oxo-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2c3ccccc3C[C@H]2OC(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO5S/c1-16-11-13-19(14-12-16)31(28,29)25-22-20-10-6-5-9-18(20)15-21(22)30-24(27)23(26)17-7-3-2-4-8-17/h2-14,21-22,25H,15H2,1H3/t21-,22+/m1/s1 |
| InChIKey | BURMOALIKDGWCN-YADHBBJMSA-N |
| XLogP | 3.37 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|