C25H24ClNO5S — CID 12992233
[(1R,2S)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] (2R,3S)-2-chloro-3-hydroxy-3-phenylpropanoate (PubChem CID 12992233) has the molecular formula C25H24ClNO5S and a molecular weight of 485.99 g/mol. Its IUPAC name is [(1R,2S)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] (2R,3S)-2-chloro-3-hydroxy-3-phenylpropanoate.
| Compound Name | [(1R,2S)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] (2R,3S)-2-chloro-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 12992233 |
| Molecular Formula | C25H24ClNO5S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [(1R,2S)-1-[(4-methylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-2-yl] (2R,3S)-2-chloro-3-hydroxy-3-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2c3ccccc3C[C@@H]2OC(=O)[C@H](Cl)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClNO5S/c1-16-11-13-19(14-12-16)33(30,31)27-23-20-10-6-5-9-18(20)15-21(23)32-25(29)22(26)24(28)17-7-3-2-4-8-17/h2-14,21-24,27-28H,15H2,1H3/t21-,22+,23+,24-/m0/s1 |
| InChIKey | SKADQRXWUCDEGZ-KEZOAJOQSA-N |
| XLogP | 3.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|